C46H38Cl2N8S2 — CID 157388209
2-[3-chloro-4-(2-methyl-8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]ethanamine (PubChem CID 157388209) has the molecular formula C46H38Cl2N8S2 and a molecular weight of 837.91 g/mol. Its IUPAC name is 2-[3-chloro-4-(2-methyl-8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]ethanamine.
| Compound Name | 2-[3-chloro-4-(2-methyl-8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 157388209 |
| Molecular Formula | C46H38Cl2N8S2 |
| Molecular Weight | 837.91 g/mol |
| Exact Mass | 836.20 |
| IUPAC Name | 2-[3-chloro-4-(2-methyl-8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]ethanamine |
| SMILES | Cc1nc2cnc3ccc(-c4cccs4)cc3c2n1-c1ccc(CCN)cc1Cl.Cc1nc2cnc3ccc(-c4cccs4)cc3c2n1-c1ccc(CCN)cc1Cl |
| InChI | InChI=1S/2C23H19ClN4S/c2*1-14-27-20-13-26-19-6-5-16(22-3-2-10-29-22)12-17(19)23(20)28(14)21-7-4-15(8-9-25)11-18(21)24/h2*2-7,10-13H,8-9,25H2,1H3 |
| InChIKey | BLRLLXSHWMEGLH-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.91 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |