C24H31N3O4 — CID 157402429
2-(6-methylidene-2-oxopiperidin-3-yl)-5-(2-morpholin-4-ylcyclohexyl)oxy-3H-isoindol-1-one (PubChem CID 157402429) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-(6-methylidene-2-oxopiperidin-3-yl)-5-(2-morpholin-4-ylcyclohexyl)oxy-3H-isoindol-1-one.
| Compound Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-(2-morpholin-4-ylcyclohexyl)oxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 157402429 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-(2-morpholin-4-ylcyclohexyl)oxy-3H-isoindol-1-one |
| SMILES | C=C1CCC(N2Cc3cc(OC4CCCCC4N4CCOCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H31N3O4/c1-16-6-9-21(23(28)25-16)27-15-17-14-18(7-8-19(17)24(27)29)31-22-5-3-2-4-20(22)26-10-12-30-13-11-26/h7-8,14,20-22H,1-6,9-13,15H2,(H,25,28) |
| InChIKey | BNICZGZOXWBUIX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |