C27H37N3O5 — CID 166469916
3-[6-[2-(azetidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;oxane (PubChem CID 166469916) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-[6-[2-(azetidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;oxane.
| Compound Name | 3-[6-[2-(azetidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;oxane |
|---|---|
| PubChem CID | 166469916 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 3-[6-[2-(azetidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;oxane |
| SMILES | C1CCOCC1.O=C1CCC(N2Cc3cc(OC4CCCCC4N4CCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H27N3O4.C5H10O/c26-20-9-8-18(21(27)23-20)25-13-14-12-15(6-7-16(14)22(25)28)29-19-5-2-1-4-17(19)24-10-3-11-24;1-2-4-6-5-3-1/h6-7,12,17-19H,1-5,8-11,13H2,(H,23,26,27);1-5H2 |
| InChIKey | ANENMLVKICISNH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|