C24H29F2N3O4 — CID 175619859
3-[6-[(1R,2R)-2-(4,4-difluoropiperidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 175619859) has the molecular formula C24H29F2N3O4 and a molecular weight of 461.51 g/mol. Its IUPAC name is 3-[6-[(1R,2R)-2-(4,4-difluoropiperidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1R,2R)-2-(4,4-difluoropiperidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175619859 |
| Molecular Formula | C24H29F2N3O4 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 3-[6-[(1R,2R)-2-(4,4-difluoropiperidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@@H]4CCCC[C@H]4N4CCC(F)(F)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H29F2N3O4/c25-24(26)9-11-28(12-10-24)18-3-1-2-4-20(18)33-16-5-6-17-15(13-16)14-29(23(17)32)19-7-8-21(30)27-22(19)31/h5-6,13,18-20H,1-4,7-12,14H2,(H,27,30,31)/t18-,19?,20-/m1/s1 |
| InChIKey | XUIJNOZBWGXEPR-YSSMNDQQSA-N |
| XLogP | 2.87 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|