C23H27F2N3O4 — CID 153392053
3-[6-[(2R)-2-(3,3-difluoropyrrolidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 153392053) has the molecular formula C23H27F2N3O4 and a molecular weight of 447.48 g/mol. Its IUPAC name is 3-[6-[(2R)-2-(3,3-difluoropyrrolidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(2R)-2-(3,3-difluoropyrrolidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 153392053 |
| Molecular Formula | C23H27F2N3O4 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 3-[6-[(2R)-2-(3,3-difluoropyrrolidin-1-yl)cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC4CCCC[C@H]4N4CCC(F)(F)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H27F2N3O4/c24-23(25)9-10-27(13-23)17-3-1-2-4-19(17)32-15-5-6-16-14(11-15)12-28(22(16)31)18-7-8-20(29)26-21(18)30/h5-6,11,17-19H,1-4,7-10,12-13H2,(H,26,29,30)/t17-,18?,19?/m1/s1 |
| InChIKey | VODVFEJFACDZRH-LMDPOFIKSA-N |
| XLogP | 2.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|