About 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate
5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate (PubChem CID 157403267) has the molecular formula C13H10Br2N4O6
and a molecular weight of 478.05 g/mol. Its IUPAC name is 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate.
Molecular Properties
| Compound Name | 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate |
| PubChem CID | 157403267 |
| Molecular Formula | C13H10Br2N4O6 |
| Molecular Weight | 478.05 g/mol |
| Exact Mass | 475.90 |
| IUPAC Name | 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate |
| SMILES | COC(=O)Cc1cc(Br)cnc1[N+](=O)[O-].O=[N+]([O-])c1ccc(Br)cn1 |
| InChI | InChI=1S/C8H7BrN2O4.C5H3BrN2O2/c1-15-7(12)3-5-2-6(9)4-10-8(5)11(13)14;6-4-1-2-5(7-3-4)8(9)10/h2,4H,3H2,1H3;1-3H |
| InChIKey | BNKPAEFOEWPIDM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 138.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.05 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate?
The IUPAC name of 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate (CID 157403267) is 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate.
What is the SMILES notation for 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate?
The canonical SMILES for 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate is COC(=O)Cc1cc(Br)cnc1[N+](=O)[O-].O=[N+]([O-])c1ccc(Br)cn1.
What is the InChIKey of 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate?
The InChIKey is BNKPAEFOEWPIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2O4.C5H3BrN2O2/c1-15-7(12)3-5-2-6(9)4-10-8(5)11(13)14;6-4-1-2-5(7-3-4)8(9)10/h2,4H,3H2,1H3;1-3H.
What are the key properties of 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate?
5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate has a molecular weight of 478.05 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-nitropyridine;methyl 2-(5-bromo-2-nitro-3-pyridinyl)acetate is sourced from PubChem (CID 157403267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).