C40H57N5O6 — CID 157403993
methyl 4-amino-1-[(2R)-6-amino-2-[[(2S,5S)-5-benzyl-2-(2-methylpropyl)-4,7-dioxo-7-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]heptanoyl]amino]hexanoyl]piperidine-4-carboxylate (PubChem CID 157403993) has the molecular formula C40H57N5O6 and a molecular weight of 703.93 g/mol. Its IUPAC name is methyl 4-amino-1-[(2R)-6-amino-2-[[(2S,5S)-5-benzyl-2-(2-methylpropyl)-4,7-dioxo-7-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]heptanoyl]amino]hexanoyl]piperidine-4-carboxylate.
| Compound Name | methyl 4-amino-1-[(2R)-6-amino-2-[[(2S,5S)-5-benzyl-2-(2-methylpropyl)-4,7-dioxo-7-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]heptanoyl]amino]hexanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 157403993 |
| Molecular Formula | C40H57N5O6 |
| Molecular Weight | 703.93 g/mol |
| Exact Mass | 703.43 |
| IUPAC Name | methyl 4-amino-1-[(2R)-6-amino-2-[[(2S,5S)-5-benzyl-2-(2-methylpropyl)-4,7-dioxo-7-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]heptanoyl]amino]hexanoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1(N)CCN(C(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)[C@H](CC(=O)[C@H]2Cc3ccccc3CN2)Cc2ccccc2)CC(C)C)CC1 |
| InChI | InChI=1S/C40H57N5O6/c1-27(2)21-32(37(48)44-33(15-9-10-18-41)38(49)45-19-16-40(42,17-20-45)39(50)51-3)25-35(46)31(22-28-11-5-4-6-12-28)24-36(47)34-23-29-13-7-8-14-30(29)26-43-34/h4-8,11-14,27,31-34,43H,9-10,15-26,41-42H2,1-3H3,(H,44,48)/t31-,32-,33+,34+/m0/s1 |
| InChIKey | WCDBLRZVXWUEQV-PSWJWLENSA-N |
| XLogP | 3.25 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.93 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|