C19H11Cl6N3O4 — CID 157405149
benzyl 4-amino-3,5,6-trichloropyridine-2-carboxylate;3,4,5-trichloropyridine-2-carboxylic acid (PubChem CID 157405149) has the molecular formula C19H11Cl6N3O4 and a molecular weight of 558.03 g/mol. Its IUPAC name is benzyl 4-amino-3,5,6-trichloropyridine-2-carboxylate;3,4,5-trichloropyridine-2-carboxylic acid.
| Compound Name | benzyl 4-amino-3,5,6-trichloropyridine-2-carboxylate;3,4,5-trichloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 157405149 |
| Molecular Formula | C19H11Cl6N3O4 |
| Molecular Weight | 558.03 g/mol |
| Exact Mass | 554.89 |
| IUPAC Name | benzyl 4-amino-3,5,6-trichloropyridine-2-carboxylate;3,4,5-trichloropyridine-2-carboxylic acid |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)OCc2ccccc2)c1Cl.O=C(O)c1ncc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl3N2O2.C6H2Cl3NO2/c14-8-10(17)9(15)12(16)18-11(8)13(19)20-6-7-4-2-1-3-5-7;7-2-1-10-5(6(11)12)4(9)3(2)8/h1-5H,6H2,(H2,17,18);1H,(H,11,12) |
| InChIKey | BNQCGWRHZUEVSL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.03 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|