C17H22N+ — CID 157406942
1,3-dimethyl-2-[2-methyl-4-(2,2,2-trideuterioethyl)phenyl]-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 157406942) has the molecular formula C17H22N+ and a molecular weight of 246.41 g/mol. Its IUPAC name is 1,3-dimethyl-2-[2-methyl-4-(2,2,2-trideuterioethyl)phenyl]-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1,3-dimethyl-2-[2-methyl-4-(2,2,2-trideuterioethyl)phenyl]-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 157406942 |
| Molecular Formula | C17H22N+ |
| Molecular Weight | 246.41 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1,3-dimethyl-2-[2-methyl-4-(2,2,2-trideuterioethyl)phenyl]-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])Cc1ccc(-c2c(C)cc(C([2H])([2H])[2H])c[n+]2C)c(C)c1 |
| InChI | InChI=1S/C17H22N/c1-6-15-7-8-16(13(3)10-15)17-14(4)9-12(2)11-18(17)5/h7-11H,6H2,1-5H3/q+1/i1D3,2D3 |
| InChIKey | DWPPCTREQDFPJL-WFGJKAKNSA-N |
| XLogP | 3.67 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|