C25H29ClF3NO6 — CID 157407698
4-(8-chloro-4,4-dimethyl-2,3-dihydropyrano[2,3-c]pyridin-6-yl)-5,5,5-trifluoro-4-hydroxy-1-[4-[(2R)-2-hydroxypropoxy]-3-methoxyphenyl]pentan-1-one (PubChem CID 157407698) has the molecular formula C25H29ClF3NO6 and a molecular weight of 531.96 g/mol. Its IUPAC name is 4-(8-chloro-4,4-dimethyl-2,3-dihydropyrano[2,3-c]pyridin-6-yl)-5,5,5-trifluoro-4-hydroxy-1-[4-[(2R)-2-hydroxypropoxy]-3-methoxyphenyl]pentan-1-one.
| Compound Name | 4-(8-chloro-4,4-dimethyl-2,3-dihydropyrano[2,3-c]pyridin-6-yl)-5,5,5-trifluoro-4-hydroxy-1-[4-[(2R)-2-hydroxypropoxy]-3-methoxyphenyl]pentan-1-one |
|---|---|
| PubChem CID | 157407698 |
| Molecular Formula | C25H29ClF3NO6 |
| Molecular Weight | 531.96 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 4-(8-chloro-4,4-dimethyl-2,3-dihydropyrano[2,3-c]pyridin-6-yl)-5,5,5-trifluoro-4-hydroxy-1-[4-[(2R)-2-hydroxypropoxy]-3-methoxyphenyl]pentan-1-one |
| SMILES | COc1cc(C(=O)CCC(O)(c2cc3c(c(Cl)n2)OCCC3(C)C)C(F)(F)F)ccc1OC[C@@H](C)O |
| InChI | InChI=1S/C25H29ClF3NO6/c1-14(31)13-36-18-6-5-15(11-19(18)34-4)17(32)7-8-24(33,25(27,28)29)20-12-16-21(22(26)30-20)35-10-9-23(16,2)3/h5-6,11-12,14,31,33H,7-10,13H2,1-4H3/t14-,24?/m1/s1 |
| InChIKey | AEADUFWEBYTVLE-GMBBYQRISA-N |
| XLogP | 4.98 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.96 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|