C23H26ClF3N2O5 — CID 161068453
4-(7-chloro-3,3-dimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-yl)-5,5,5-trifluoro-4-hydroxy-1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]pentan-1-one (PubChem CID 161068453) has the molecular formula C23H26ClF3N2O5 and a molecular weight of 502.92 g/mol. Its IUPAC name is 4-(7-chloro-3,3-dimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-yl)-5,5,5-trifluoro-4-hydroxy-1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]pentan-1-one.
| Compound Name | 4-(7-chloro-3,3-dimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-yl)-5,5,5-trifluoro-4-hydroxy-1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]pentan-1-one |
|---|---|
| PubChem CID | 161068453 |
| Molecular Formula | C23H26ClF3N2O5 |
| Molecular Weight | 502.92 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 4-(7-chloro-3,3-dimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-yl)-5,5,5-trifluoro-4-hydroxy-1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]pentan-1-one |
| SMILES | COc1cc(C(=O)CCC(O)(c2cc3c(c(Cl)n2)NCC3(C)C)C(F)(F)F)ccc1OCCO |
| InChI | InChI=1S/C23H26ClF3N2O5/c1-21(2)12-28-19-14(21)11-18(29-20(19)24)22(32,23(25,26)27)7-6-15(31)13-4-5-16(34-9-8-30)17(10-13)33-3/h4-5,10-11,28,30,32H,6-9,12H2,1-3H3 |
| InChIKey | SJGRSGTVELFECX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.92 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|