C24H29N3O4 — CID 157409213
methyl 2-[4-[2-[1-(methylamino)but-3-enyl]-6-oxo-1H-pyridin-4-yl]-3-(2-methylbut-3-enoylamino)phenyl]acetate (PubChem CID 157409213) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is methyl 2-[4-[2-[1-(methylamino)but-3-enyl]-6-oxo-1H-pyridin-4-yl]-3-(2-methylbut-3-enoylamino)phenyl]acetate.
| Compound Name | methyl 2-[4-[2-[1-(methylamino)but-3-enyl]-6-oxo-1H-pyridin-4-yl]-3-(2-methylbut-3-enoylamino)phenyl]acetate |
|---|---|
| PubChem CID | 157409213 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | methyl 2-[4-[2-[1-(methylamino)but-3-enyl]-6-oxo-1H-pyridin-4-yl]-3-(2-methylbut-3-enoylamino)phenyl]acetate |
| SMILES | C=CCC(NC)c1cc(-c2ccc(CC(=O)OC)cc2NC(=O)C(C)C=C)cc(=O)[nH]1 |
| InChI | InChI=1S/C24H29N3O4/c1-6-8-19(25-4)21-13-17(14-22(28)26-21)18-10-9-16(12-23(29)31-5)11-20(18)27-24(30)15(3)7-2/h6-7,9-11,13-15,19,25H,1-2,8,12H2,3-5H3,(H,26,28)(H,27,30) |
| InChIKey | BEXDZOWYFUETAN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|