C20H24N2O3 — CID 159826896
methyl 2-[3-amino-4-[2-methoxy-6-[(2S)-pent-4-en-2-yl]-4-pyridinyl]phenyl]acetate (PubChem CID 159826896) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl 2-[3-amino-4-[2-methoxy-6-[(2S)-pent-4-en-2-yl]-4-pyridinyl]phenyl]acetate.
| Compound Name | methyl 2-[3-amino-4-[2-methoxy-6-[(2S)-pent-4-en-2-yl]-4-pyridinyl]phenyl]acetate |
|---|---|
| PubChem CID | 159826896 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | methyl 2-[3-amino-4-[2-methoxy-6-[(2S)-pent-4-en-2-yl]-4-pyridinyl]phenyl]acetate |
| SMILES | C=CC[C@H](C)c1cc(-c2ccc(CC(=O)OC)cc2N)cc(OC)n1 |
| InChI | InChI=1S/C20H24N2O3/c1-5-6-13(2)18-11-15(12-19(22-18)24-3)16-8-7-14(9-17(16)21)10-20(23)25-4/h5,7-9,11-13H,1,6,10,21H2,2-4H3/t13-/m0/s1 |
| InChIKey | UXTVYKZDLDGXOA-ZDUSSCGKSA-N |
| XLogP | 3.73 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|