C27H38B2N4O5 — CID 157409947
3-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-one;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (PubChem CID 157409947) has the molecular formula C27H38B2N4O5 and a molecular weight of 520.25 g/mol. Its IUPAC name is 3-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-one;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
| Compound Name | 3-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-one;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 157409947 |
| Molecular Formula | C27H38B2N4O5 |
| Molecular Weight | 520.25 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 3-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-one;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| SMILES | CC1(C)OB(c2cn[nH]c2)OC1(C)C.CC1(C)OB(c2cnn(C(=O)CCc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C18H23BN2O3.C9H15BN2O2/c1-17(2)18(3,4)24-19(23-17)15-12-20-21(13-15)16(22)11-10-14-8-6-5-7-9-14;1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7/h5-9,12-13H,10-11H2,1-4H3;5-6H,1-4H3,(H,11,12) |
| InChIKey | BODWNVPWBUHKAK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|