C19H18F2N4O4S — CID 157410289
2-(2,2-difluoropropoxy)-5-(3-ethoxysulfanyloxy-5-pyridin-2-yloxy-2-pyridinyl)pyrazine (PubChem CID 157410289) has the molecular formula C19H18F2N4O4S and a molecular weight of 436.44 g/mol. Its IUPAC name is 2-(2,2-difluoropropoxy)-5-(3-ethoxysulfanyloxy-5-pyridin-2-yloxy-2-pyridinyl)pyrazine.
| Compound Name | 2-(2,2-difluoropropoxy)-5-(3-ethoxysulfanyloxy-5-pyridin-2-yloxy-2-pyridinyl)pyrazine |
|---|---|
| PubChem CID | 157410289 |
| Molecular Formula | C19H18F2N4O4S |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-(2,2-difluoropropoxy)-5-(3-ethoxysulfanyloxy-5-pyridin-2-yloxy-2-pyridinyl)pyrazine |
| SMILES | CCOSOc1cc(Oc2ccccn2)cnc1-c1cnc(OCC(C)(F)F)cn1 |
| InChI | InChI=1S/C19H18F2N4O4S/c1-3-27-30-29-15-8-13(28-16-6-4-5-7-22-16)9-25-18(15)14-10-24-17(11-23-14)26-12-19(2,20)21/h4-11H,3,12H2,1-2H3 |
| InChIKey | BOEWWDNLANBAAD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|