C16H11F3N2O2 — CID 629341
8-phenoxy-2-(2,2,2-trifluoroethoxy)-1,5-naphthyridine (PubChem CID 629341) has the molecular formula C16H11F3N2O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is 8-phenoxy-2-(2,2,2-trifluoroethoxy)-1,5-naphthyridine.
| Compound Name | 8-phenoxy-2-(2,2,2-trifluoroethoxy)-1,5-naphthyridine |
|---|---|
| PubChem CID | 629341 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 8-phenoxy-2-(2,2,2-trifluoroethoxy)-1,5-naphthyridine |
| SMILES | FC(F)(F)COc1ccc2nccc(Oc3ccccc3)c2n1 |
| InChI | InChI=1S/C16H11F3N2O2/c17-16(18,19)10-22-14-7-6-12-15(21-14)13(8-9-20-12)23-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | VZTUIGFYOCXUBY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |