C17H13F2N3O2 — CID 86296849
2-[7-[(3,4-difluorophenyl)methoxy]-1,5-naphthyridin-3-yl]acetamide (PubChem CID 86296849) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-[7-[(3,4-difluorophenyl)methoxy]-1,5-naphthyridin-3-yl]acetamide.
| Compound Name | 2-[7-[(3,4-difluorophenyl)methoxy]-1,5-naphthyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 86296849 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[7-[(3,4-difluorophenyl)methoxy]-1,5-naphthyridin-3-yl]acetamide |
| SMILES | NC(=O)Cc1cnc2cc(OCc3ccc(F)c(F)c3)cnc2c1 |
| InChI | InChI=1S/C17H13F2N3O2/c18-13-2-1-10(3-14(13)19)9-24-12-6-16-15(22-8-12)4-11(7-21-16)5-17(20)23/h1-4,6-8H,5,9H2,(H2,20,23) |
| InChIKey | ODNHVKCPQNXAJS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |