C17H13FN2O2 — CID 90444036
1-[7-[(4-fluorophenyl)methoxy]-1,5-naphthyridin-3-yl]ethanone (PubChem CID 90444036) has the molecular formula C17H13FN2O2 and a molecular weight of 296.30 g/mol. Its IUPAC name is 1-[7-[(4-fluorophenyl)methoxy]-1,5-naphthyridin-3-yl]ethanone.
| Compound Name | 1-[7-[(4-fluorophenyl)methoxy]-1,5-naphthyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 90444036 |
| Molecular Formula | C17H13FN2O2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-[7-[(4-fluorophenyl)methoxy]-1,5-naphthyridin-3-yl]ethanone |
| SMILES | CC(=O)c1cnc2cc(OCc3ccc(F)cc3)cnc2c1 |
| InChI | InChI=1S/C17H13FN2O2/c1-11(21)13-6-16-17(19-8-13)7-15(9-20-16)22-10-12-2-4-14(18)5-3-12/h2-9H,10H2,1H3 |
| InChIKey | OXVJVHPNURODQF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |