C42H26F14N2O2 — CID 157410364
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-prop-1-enylpyridine;2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-propylpyridine (PubChem CID 157410364) has the molecular formula C42H26F14N2O2 and a molecular weight of 856.65 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-prop-1-enylpyridine;2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-propylpyridine.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-prop-1-enylpyridine;2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-propylpyridine |
|---|---|
| PubChem CID | 157410364 |
| Molecular Formula | C42H26F14N2O2 |
| Molecular Weight | 856.65 g/mol |
| Exact Mass | 856.18 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-prop-1-enylpyridine;2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-propylpyridine |
| SMILES | CC=Cc1ccc(-c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)nc1.CCCc1ccc(-c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C21H14F7NO.C21H12F7NO/c2*1-2-3-11-4-5-18(29-10-11)12-6-14(22)19(15(23)7-12)21(27,28)30-13-8-16(24)20(26)17(25)9-13/h4-10H,2-3H2,1H3;2-10H,1H3 |
| InChIKey | BOFDAVGVIKGQBZ-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.65 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|