C33H33ClN2O9 — CID 157414676
1-chloro-6,7-dimethoxyisoquinoline;6,7-dimethoxy-2H-isoquinolin-1-one;(E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 157414676) has the molecular formula C33H33ClN2O9 and a molecular weight of 637.09 g/mol. Its IUPAC name is 1-chloro-6,7-dimethoxyisoquinoline;6,7-dimethoxy-2H-isoquinolin-1-one;(E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | 1-chloro-6,7-dimethoxyisoquinoline;6,7-dimethoxy-2H-isoquinolin-1-one;(E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 157414676 |
| Molecular Formula | C33H33ClN2O9 |
| Molecular Weight | 637.09 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | 1-chloro-6,7-dimethoxyisoquinoline;6,7-dimethoxy-2H-isoquinolin-1-one;(E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc2cc[nH]c(=O)c2cc1OC.COc1cc2ccnc(Cl)c2cc1OC.COc1ccc(/C=C/C(=O)O)cc1OC |
| InChI | InChI=1S/C11H10ClNO2.C11H11NO3.C11H12O4/c1-14-9-5-7-3-4-13-11(12)8(7)6-10(9)15-2;1-14-9-5-7-3-4-12-11(13)8(7)6-10(9)15-2;1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-6H,1-2H3;3-6H,1-2H3,(H,12,13);3-7H,1-2H3,(H,12,13)/b;;6-4+ |
| InChIKey | BORWYKRUHIXGLJ-DDKPUMFKSA-N |
| XLogP | 6.25 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.09 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|