C19H25N3O6 — CID 157416529
N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-(3-oxobutyl)pyrrole-2,5-dione (PubChem CID 157416529) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-(3-oxobutyl)pyrrole-2,5-dione.
| Compound Name | N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-(3-oxobutyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 157416529 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-(3-oxobutyl)pyrrole-2,5-dione |
| SMILES | CC(=O)CCN1C(=O)C=CC1=O.CCCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H16N2O3.C8H9NO3/c1-2-3-7-12-9(14)6-8-13-10(15)4-5-11(13)16;1-6(10)4-5-9-7(11)2-3-8(9)12/h4-5H,2-3,6-8H2,1H3,(H,12,14);2-3H,4-5H2,1H3 |
| InChIKey | BOXIWIHZKNYGPI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|