C21H28N2OS — CID 15741719
(E)-N-[5-[benzyl(ethyl)amino]pentyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 15741719) has the molecular formula C21H28N2OS and a molecular weight of 356.54 g/mol. Its IUPAC name is (E)-N-[5-[benzyl(ethyl)amino]pentyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[benzyl(ethyl)amino]pentyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 15741719 |
| Molecular Formula | C21H28N2OS |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (E)-N-[5-[benzyl(ethyl)amino]pentyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCN(CCCCCNC(=O)/C=C/c1cccs1)Cc1ccccc1 |
| InChI | InChI=1S/C21H28N2OS/c1-2-23(18-19-10-5-3-6-11-19)16-8-4-7-15-22-21(24)14-13-20-12-9-17-25-20/h3,5-6,9-14,17H,2,4,7-8,15-16,18H2,1H3,(H,22,24)/b14-13+ |
| InChIKey | JGBJKBGMMOONJS-BUHFOSPRSA-N |
| XLogP | 4.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|