C28H34N4O4 — CID 157418452
4-[5-[2-(5-cyano-1H-imidazol-2-yl)-2-oxoethyl]-6-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]-2,6,6-trimethyloxane-2-carboxylic acid (PubChem CID 157418452) has the molecular formula C28H34N4O4 and a molecular weight of 494.63 g/mol. Its IUPAC name is 4-[5-[2-(5-cyano-1H-imidazol-2-yl)-2-oxoethyl]-6-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]-2,6,6-trimethyloxane-2-carboxylic acid.
| Compound Name | 4-[5-[2-(5-cyano-1H-imidazol-2-yl)-2-oxoethyl]-6-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]-2,6,6-trimethyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 157418452 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 4-[5-[2-(5-cyano-1H-imidazol-2-yl)-2-oxoethyl]-6-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]-2,6,6-trimethyloxane-2-carboxylic acid |
| SMILES | [2H]C1=C(c2nc(C3CC(C)(C)OC(C)(C(=O)O)C3)ccc2CC(=O)c2ncc(C#N)[nH]2)C([2H])([2H])CC(C)(C)C1[2H] |
| InChI | InChI=1S/C28H34N4O4/c1-26(2)10-8-17(9-11-26)23-18(12-22(33)24-30-16-20(15-29)31-24)6-7-21(32-23)19-13-27(3,4)36-28(5,14-19)25(34)35/h6-8,16,19H,9-14H2,1-5H3,(H,30,31)(H,34,35)/i8D,9D2,10D |
| InChIKey | PLZYMZWQRCFPLH-LRGHJICDSA-N |
| XLogP | 5.21 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |