C16H13Cl3F2N4O3 — CID 157419948
1-(3-chloro-2-fluorophenyl)-5-(3-chloro-4-fluorophenyl)-N-hydroxyimidazole-4-carboxamide;hydroxylamine;hydrochloride (PubChem CID 157419948) has the molecular formula C16H13Cl3F2N4O3 and a molecular weight of 453.66 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-5-(3-chloro-4-fluorophenyl)-N-hydroxyimidazole-4-carboxamide;hydroxylamine;hydrochloride.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-5-(3-chloro-4-fluorophenyl)-N-hydroxyimidazole-4-carboxamide;hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 157419948 |
| Molecular Formula | C16H13Cl3F2N4O3 |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-5-(3-chloro-4-fluorophenyl)-N-hydroxyimidazole-4-carboxamide;hydroxylamine;hydrochloride |
| SMILES | Cl.NO.O=C(NO)c1ncn(-c2cccc(Cl)c2F)c1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H9Cl2F2N3O2.ClH.H3NO/c17-9-2-1-3-12(13(9)20)23-7-21-14(16(24)22-25)15(23)8-4-5-11(19)10(18)6-8;;1-2/h1-7,25H,(H,22,24);1H;2H,1H2 |
| InChIKey | BPHFDJWJOYIROM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|