C38H35Br3N4O4 — CID 157420513
3-bromo-5-isocyano-1H-indole;3-bromo-5-isocyano-1-[[4-(2-methoxyethoxy)phenyl]methyl]indole;1-(bromomethyl)-4-(2-methoxyethoxy)benzene (PubChem CID 157420513) has the molecular formula C38H35Br3N4O4 and a molecular weight of 851.43 g/mol. Its IUPAC name is 3-bromo-5-isocyano-1H-indole;3-bromo-5-isocyano-1-[[4-(2-methoxyethoxy)phenyl]methyl]indole;1-(bromomethyl)-4-(2-methoxyethoxy)benzene.
| Compound Name | 3-bromo-5-isocyano-1H-indole;3-bromo-5-isocyano-1-[[4-(2-methoxyethoxy)phenyl]methyl]indole;1-(bromomethyl)-4-(2-methoxyethoxy)benzene |
|---|---|
| PubChem CID | 157420513 |
| Molecular Formula | C38H35Br3N4O4 |
| Molecular Weight | 851.43 g/mol |
| Exact Mass | 848.02 |
| IUPAC Name | 3-bromo-5-isocyano-1H-indole;3-bromo-5-isocyano-1-[[4-(2-methoxyethoxy)phenyl]methyl]indole;1-(bromomethyl)-4-(2-methoxyethoxy)benzene |
| SMILES | COCCOc1ccc(CBr)cc1.[C-]#[N+]c1ccc2[nH]cc(Br)c2c1.[C-]#[N+]c1ccc2c(c1)c(Br)cn2Cc1ccc(OCCOC)cc1 |
| InChI | InChI=1S/C19H17BrN2O2.C10H13BrO2.C9H5BrN2/c1-21-15-5-8-19-17(11-15)18(20)13-22(19)12-14-3-6-16(7-4-14)24-10-9-23-2;1-12-6-7-13-10-4-2-9(8-11)3-5-10;1-11-6-2-3-9-7(4-6)8(10)5-12-9/h3-8,11,13H,9-10,12H2,2H3;2-5H,6-8H2,1H3;2-5,12H |
| InChIKey | BPIRHPZYQQHSPM-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 66.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.43 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|