About 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate
3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate (PubChem CID 157420944) has the molecular formula C24H20Cl2N2O4
and a molecular weight of 471.34 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate |
| PubChem CID | 157420944 |
| Molecular Formula | C24H20Cl2N2O4 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1-c1ccc(Cl)cc1.O=C(O)c1[nH]ccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12ClNO2.C11H8ClNO2/c1-2-17-13(16)12-11(7-8-15-12)9-3-5-10(14)6-4-9;12-8-3-1-7(2-4-8)9-5-6-13-10(9)11(14)15/h3-8,15H,2H2,1H3;1-6,13H,(H,14,15) |
| InChIKey | BPJYOSIEFDYEEW-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate?
The IUPAC name of 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate (CID 157420944) is 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate.
What is the SMILES notation for 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate?
The canonical SMILES for 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate is CCOC(=O)c1[nH]ccc1-c1ccc(Cl)cc1.O=C(O)c1[nH]ccc1-c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate?
The InChIKey is BPJYOSIEFDYEEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO2.C11H8ClNO2/c1-2-17-13(16)12-11(7-8-15-12)9-3-5-10(14)6-4-9;12-8-3-1-7(2-4-8)9-5-6-13-10(9)11(14)15/h3-8,15H,2H2,1H3;1-6,13H,(H,14,15).
What are the key properties of 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate?
3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate has a molecular weight of 471.34 g/mol, XLogP of 6.55, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid;ethyl 3-(4-chlorophenyl)-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 157420944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).