C49H86N6 — CID 157426690
1-N,4-N-bis(5-methylhexan-2-yl)benzene-1,4-diamine;1-N-butan-2-yl-2-N-pentan-3-ylbenzene-1,2-diamine;1-N,4-N-di(butan-2-yl)benzene-1,4-diamine (PubChem CID 157426690) has the molecular formula C49H86N6 and a molecular weight of 759.27 g/mol. Its IUPAC name is 1-N,4-N-bis(5-methylhexan-2-yl)benzene-1,4-diamine;1-N-butan-2-yl-2-N-pentan-3-ylbenzene-1,2-diamine;1-N,4-N-di(butan-2-yl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(5-methylhexan-2-yl)benzene-1,4-diamine;1-N-butan-2-yl-2-N-pentan-3-ylbenzene-1,2-diamine;1-N,4-N-di(butan-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 157426690 |
| Molecular Formula | C49H86N6 |
| Molecular Weight | 759.27 g/mol |
| Exact Mass | 758.69 |
| IUPAC Name | 1-N,4-N-bis(5-methylhexan-2-yl)benzene-1,4-diamine;1-N-butan-2-yl-2-N-pentan-3-ylbenzene-1,2-diamine;1-N,4-N-di(butan-2-yl)benzene-1,4-diamine |
| SMILES | CC(C)CCC(C)Nc1ccc(NC(C)CCC(C)C)cc1.CCC(C)Nc1ccc(NC(C)CC)cc1.CCC(C)Nc1ccccc1NC(CC)CC |
| InChI | InChI=1S/C20H36N2.C15H26N2.C14H24N2/c1-15(2)7-9-17(5)21-19-11-13-20(14-12-19)22-18(6)10-8-16(3)4;1-5-12(4)16-14-10-8-9-11-15(14)17-13(6-2)7-3;1-5-11(3)15-13-7-9-14(10-8-13)16-12(4)6-2/h11-18,21-22H,7-10H2,1-6H3;8-13,16-17H,5-7H2,1-4H3;7-12,15-16H,5-6H2,1-4H3 |
| InChIKey | BQASIFCOHSPHSX-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.27 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|