C24H20BBrCl2F6N2O2 — CID 157427951
5-bromo-6-chloro-2-(trifluoromethyl)-1H-indole;6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1H-indole (PubChem CID 157427951) has the molecular formula C24H20BBrCl2F6N2O2 and a molecular weight of 644.05 g/mol. Its IUPAC name is 5-bromo-6-chloro-2-(trifluoromethyl)-1H-indole;6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1H-indole.
| Compound Name | 5-bromo-6-chloro-2-(trifluoromethyl)-1H-indole;6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1H-indole |
|---|---|
| PubChem CID | 157427951 |
| Molecular Formula | C24H20BBrCl2F6N2O2 |
| Molecular Weight | 644.05 g/mol |
| Exact Mass | 642.01 |
| IUPAC Name | 5-bromo-6-chloro-2-(trifluoromethyl)-1H-indole;6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1H-indole |
| SMILES | CC1(C)OB(c2cc3cc(C(F)(F)F)[nH]c3cc2Cl)OC1(C)C.FC(F)(F)c1cc2cc(Br)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C15H16BClF3NO2.C9H4BrClF3N/c1-13(2)14(3,4)23-16(22-13)9-5-8-6-12(15(18,19)20)21-11(8)7-10(9)17;10-5-1-4-2-8(9(12,13)14)15-7(4)3-6(5)11/h5-7,21H,1-4H3;1-3,15H |
| InChIKey | BQEKKZAWZWPUDL-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 50.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.05 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|