C34H22BBrCl4F10N2O2 — CID 158488236
5-bromo-6-chloro-2-(1,1,2,2,2-pentafluoroethyl)-1H-indole;6-chloro-5-(2-chloro-4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-indole;(2-chloro-4-methylphenyl)boronic acid (PubChem CID 158488236) has the molecular formula C34H22BBrCl4F10N2O2 and a molecular weight of 913.07 g/mol. Its IUPAC name is 5-bromo-6-chloro-2-(1,1,2,2,2-pentafluoroethyl)-1H-indole;6-chloro-5-(2-chloro-4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-indole;(2-chloro-4-methylphenyl)boronic acid.
| Compound Name | 5-bromo-6-chloro-2-(1,1,2,2,2-pentafluoroethyl)-1H-indole;6-chloro-5-(2-chloro-4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-indole;(2-chloro-4-methylphenyl)boronic acid |
|---|---|
| PubChem CID | 158488236 |
| Molecular Formula | C34H22BBrCl4F10N2O2 |
| Molecular Weight | 913.07 g/mol |
| Exact Mass | 909.96 |
| IUPAC Name | 5-bromo-6-chloro-2-(1,1,2,2,2-pentafluoroethyl)-1H-indole;6-chloro-5-(2-chloro-4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-indole;(2-chloro-4-methylphenyl)boronic acid |
| SMILES | Cc1ccc(-c2cc3cc(C(F)(F)C(F)(F)F)[nH]c3cc2Cl)c(Cl)c1.Cc1ccc(B(O)O)c(Cl)c1.FC(F)(F)C(F)(F)c1cc2cc(Br)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C17H10Cl2F5N.C10H4BrClF5N.C7H8BClO2/c1-8-2-3-10(12(18)4-8)11-5-9-6-15(16(20,21)17(22,23)24)25-14(9)7-13(11)19;11-5-1-4-2-8(9(13,14)10(15,16)17)18-7(4)3-6(5)12;1-5-2-3-6(8(10)11)7(9)4-5/h2-7,25H,1H3;1-3,18H;2-4,10-11H,1H3 |
| InChIKey | HIJGHNGFBJCPIN-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.07 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|