C47H31LiN5O+ — CID 157428499
lithium;8-[4-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)phenyl]quinoline;quinolin-1-ium-8-olate (PubChem CID 157428499) has the molecular formula C47H31LiN5O+ and a molecular weight of 688.74 g/mol. Its IUPAC name is lithium;8-[4-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)phenyl]quinoline;quinolin-1-ium-8-olate.
| Compound Name | lithium;8-[4-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)phenyl]quinoline;quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 157428499 |
| Molecular Formula | C47H31LiN5O+ |
| Molecular Weight | 688.74 g/mol |
| Exact Mass | 688.27 |
| IUPAC Name | lithium;8-[4-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)phenyl]quinoline;quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1cccc2ccc[nH+]c12.c1ccc2cc(-c3nc(-c4ccc(-c5cccc6cccnc56)cc4)nc(-c4ccc5ccccc5c4)n3)ccc2c1 |
| InChI | InChI=1S/C38H24N4.C9H7NO.Li/c1-3-9-30-23-32(20-14-25(30)7-1)37-40-36(41-38(42-37)33-21-15-26-8-2-4-10-31(26)24-33)29-18-16-27(17-19-29)34-13-5-11-28-12-6-22-39-35(28)34;11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-24H;1-6,11H;/q;;+1 |
| InChIKey | BQGBAOSASHUYCV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.74 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |