C15H15Cl2N2NaO2 — CID 157429238
sodium;4-(3,5-dichloro-2-pyridinyl)morpholine;phenoxide (PubChem CID 157429238) has the molecular formula C15H15Cl2N2NaO2 and a molecular weight of 349.19 g/mol. Its IUPAC name is sodium;4-(3,5-dichloro-2-pyridinyl)morpholine;phenoxide.
| Compound Name | sodium;4-(3,5-dichloro-2-pyridinyl)morpholine;phenoxide |
|---|---|
| PubChem CID | 157429238 |
| Molecular Formula | C15H15Cl2N2NaO2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | sodium;4-(3,5-dichloro-2-pyridinyl)morpholine;phenoxide |
| SMILES | Clc1cnc(N2CCOCC2)c(Cl)c1.[Na+].[O-]c1ccccc1 |
| InChI | InChI=1S/C9H10Cl2N2O.C6H6O.Na/c10-7-5-8(11)9(12-6-7)13-1-3-14-4-2-13;7-6-4-2-1-3-5-6;/h5-6H,1-4H2;1-5,7H;/q;;+1/p-1 |
| InChIKey | KXZVWCZFVBBMQK-UHFFFAOYSA-M |
| XLogP | -0.01 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |