C17H22N2O5S — CID 157430688
5-[6-(butylsulfonylamino)indol-1-yl]-4-oxopentanoic acid (PubChem CID 157430688) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is 5-[6-(butylsulfonylamino)indol-1-yl]-4-oxopentanoic acid.
| Compound Name | 5-[6-(butylsulfonylamino)indol-1-yl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 157430688 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-[6-(butylsulfonylamino)indol-1-yl]-4-oxopentanoic acid |
| SMILES | CCCCS(=O)(=O)Nc1ccc2ccn(CC(=O)CCC(=O)O)c2c1 |
| InChI | InChI=1S/C17H22N2O5S/c1-2-3-10-25(23,24)18-14-5-4-13-8-9-19(16(13)11-14)12-15(20)6-7-17(21)22/h4-5,8-9,11,18H,2-3,6-7,10,12H2,1H3,(H,21,22) |
| InChIKey | QHAONAJDNFWBDF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |