C13H19N3O2S — CID 110779248
N-(1,2-dimethylbenzimidazol-5-yl)butane-1-sulfonamide (PubChem CID 110779248) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(1,2-dimethylbenzimidazol-5-yl)butane-1-sulfonamide.
| Compound Name | N-(1,2-dimethylbenzimidazol-5-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 110779248 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(1,2-dimethylbenzimidazol-5-yl)butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc2c(c1)nc(C)n2C |
| InChI | InChI=1S/C13H19N3O2S/c1-4-5-8-19(17,18)15-11-6-7-13-12(9-11)14-10(2)16(13)3/h6-7,9,15H,4-5,8H2,1-3H3 |
| InChIKey | BUYGZAUFIOGPKO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |