C25H47ClN2O8Si — CID 157434220
ethyl 3-chloro-3-oxopropanoate;ethyl 5-(dimethylamino)-4,4-dimethyl-3,5-dioxopentanoate;N,N,2-trimethyl-1-trimethylsilyloxyprop-1-en-1-amine (PubChem CID 157434220) has the molecular formula C25H47ClN2O8Si and a molecular weight of 567.20 g/mol. Its IUPAC name is ethyl 3-chloro-3-oxopropanoate;ethyl 5-(dimethylamino)-4,4-dimethyl-3,5-dioxopentanoate;N,N,2-trimethyl-1-trimethylsilyloxyprop-1-en-1-amine.
| Compound Name | ethyl 3-chloro-3-oxopropanoate;ethyl 5-(dimethylamino)-4,4-dimethyl-3,5-dioxopentanoate;N,N,2-trimethyl-1-trimethylsilyloxyprop-1-en-1-amine |
|---|---|
| PubChem CID | 157434220 |
| Molecular Formula | C25H47ClN2O8Si |
| Molecular Weight | 567.20 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | ethyl 3-chloro-3-oxopropanoate;ethyl 5-(dimethylamino)-4,4-dimethyl-3,5-dioxopentanoate;N,N,2-trimethyl-1-trimethylsilyloxyprop-1-en-1-amine |
| SMILES | CC(C)=C(O[Si](C)(C)C)N(C)C.CCOC(=O)CC(=O)C(C)(C)C(=O)N(C)C.CCOC(=O)CC(=O)Cl |
| InChI | InChI=1S/C11H19NO4.C9H21NOSi.C5H7ClO3/c1-6-16-9(14)7-8(13)11(2,3)10(15)12(4)5;1-8(2)9(10(3)4)11-12(5,6)7;1-2-9-5(8)3-4(6)7/h6-7H2,1-5H3;1-7H3;2-3H2,1H3 |
| InChIKey | BQXBBZOTUIIIFP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|