About ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile
ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile (PubChem CID 159195678) has the molecular formula C18H27ClN2O6
and a molecular weight of 402.88 g/mol. Its IUPAC name is ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile.
Molecular Properties
| Compound Name | ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile |
| PubChem CID | 159195678 |
| Molecular Formula | C18H27ClN2O6 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile |
| SMILES | CC(C)C#N.CCOC(=O)CC(=O)C(C)(C)C#N.CCOC(=O)CC(=O)Cl |
| InChI | InChI=1S/C9H13NO3.C5H7ClO3.C4H7N/c1-4-13-8(12)5-7(11)9(2,3)6-10;1-2-9-5(8)3-4(6)7;1-4(2)3-5/h4-5H2,1-3H3;2-3H2,1H3;4H,1-2H3 |
| InChIKey | KOQAIQLUZUGEKX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 134.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile?
The IUPAC name of ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile (CID 159195678) is ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile.
What is the SMILES notation for ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile?
The canonical SMILES for ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile is CC(C)C#N.CCOC(=O)CC(=O)C(C)(C)C#N.CCOC(=O)CC(=O)Cl.
What is the InChIKey of ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile?
The InChIKey is KOQAIQLUZUGEKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3.C5H7ClO3.C4H7N/c1-4-13-8(12)5-7(11)9(2,3)6-10;1-2-9-5(8)3-4(6)7;1-4(2)3-5/h4-5H2,1-3H3;2-3H2,1H3;4H,1-2H3.
What are the key properties of ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile?
ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile has a molecular weight of 402.88 g/mol, XLogP of 2.93, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-chloro-3-oxopropanoate;ethyl 4-cyano-4-methyl-3-oxopentanoate;2-methylpropanenitrile is sourced from PubChem (CID 159195678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).