C33H41N9O6 — CID 157436347
3-ethyl-1-(2-methoxyethyl)indazol-5-amine;3-ethyl-1-(2-methoxyethyl)-5-nitroindazole;3-ethyl-5-nitro-2H-indazole (PubChem CID 157436347) has the molecular formula C33H41N9O6 and a molecular weight of 659.75 g/mol. Its IUPAC name is 3-ethyl-1-(2-methoxyethyl)indazol-5-amine;3-ethyl-1-(2-methoxyethyl)-5-nitroindazole;3-ethyl-5-nitro-2H-indazole.
| Compound Name | 3-ethyl-1-(2-methoxyethyl)indazol-5-amine;3-ethyl-1-(2-methoxyethyl)-5-nitroindazole;3-ethyl-5-nitro-2H-indazole |
|---|---|
| PubChem CID | 157436347 |
| Molecular Formula | C33H41N9O6 |
| Molecular Weight | 659.75 g/mol |
| Exact Mass | 659.32 |
| IUPAC Name | 3-ethyl-1-(2-methoxyethyl)indazol-5-amine;3-ethyl-1-(2-methoxyethyl)-5-nitroindazole;3-ethyl-5-nitro-2H-indazole |
| SMILES | CCc1[nH]nc2ccc([N+](=O)[O-])cc12.CCc1nn(CCOC)c2ccc(N)cc12.CCc1nn(CCOC)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C12H15N3O3.C12H17N3O.C9H9N3O2/c1-3-11-10-8-9(15(16)17)4-5-12(10)14(13-11)6-7-18-2;1-3-11-10-8-9(13)4-5-12(10)15(14-11)6-7-16-2;1-2-8-7-5-6(12(13)14)3-4-9(7)11-10-8/h4-5,8H,3,6-7H2,1-2H3;4-5,8H,3,6-7,13H2,1-2H3;3-5H,2H2,1H3,(H,10,11) |
| InChIKey | BRDNODDFNOQSRF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 195.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|