C39H47N9O4 — CID 157333565
5-methyl-3-(4-methyl-3-nitrophenyl)-1-propylpyrazole;5-methyl-3-(4-methyl-3-nitrophenyl)-1H-pyrazole;2-methyl-5-(5-methyl-1-propylpyrazol-3-yl)aniline (PubChem CID 157333565) has the molecular formula C39H47N9O4 and a molecular weight of 705.86 g/mol. Its IUPAC name is 5-methyl-3-(4-methyl-3-nitrophenyl)-1-propylpyrazole;5-methyl-3-(4-methyl-3-nitrophenyl)-1H-pyrazole;2-methyl-5-(5-methyl-1-propylpyrazol-3-yl)aniline.
| Compound Name | 5-methyl-3-(4-methyl-3-nitrophenyl)-1-propylpyrazole;5-methyl-3-(4-methyl-3-nitrophenyl)-1H-pyrazole;2-methyl-5-(5-methyl-1-propylpyrazol-3-yl)aniline |
|---|---|
| PubChem CID | 157333565 |
| Molecular Formula | C39H47N9O4 |
| Molecular Weight | 705.86 g/mol |
| Exact Mass | 705.38 |
| IUPAC Name | 5-methyl-3-(4-methyl-3-nitrophenyl)-1-propylpyrazole;5-methyl-3-(4-methyl-3-nitrophenyl)-1H-pyrazole;2-methyl-5-(5-methyl-1-propylpyrazol-3-yl)aniline |
| SMILES | CCCn1nc(-c2ccc(C)c(N)c2)cc1C.CCCn1nc(-c2ccc(C)c([N+](=O)[O-])c2)cc1C.Cc1cc(-c2ccc(C)c([N+](=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C14H17N3O2.C14H19N3.C11H11N3O2/c1-4-7-16-11(3)8-13(15-16)12-6-5-10(2)14(9-12)17(18)19;1-4-7-17-11(3)8-14(16-17)12-6-5-10(2)13(15)9-12;1-7-3-4-9(6-11(7)14(15)16)10-5-8(2)12-13-10/h5-6,8-9H,4,7H2,1-3H3;5-6,8-9H,4,7,15H2,1-3H3;3-6H,1-2H3,(H,12,13) |
| InChIKey | BFOMSAZEEZJBFH-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 176.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.86 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|