About (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane
(1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane (PubChem CID 157436749) has the molecular formula C12H26N2S
and a molecular weight of 230.42 g/mol. Its IUPAC name is (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane.
Molecular Properties
| Compound Name | (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane |
| PubChem CID | 157436749 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane |
| SMILES | N[C@H](CN1CCCC1)C1CCCCC1.S |
| InChI | InChI=1S/C12H24N2.H2S/c13-12(10-14-8-4-5-9-14)11-6-2-1-3-7-11;/h11-12H,1-10,13H2;1H2/t12-;/m1./s1 |
| InChIKey | BREUSPWRRFNAMA-UTONKHPSSA-N |
| XLogP | 2.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane?
The IUPAC name of (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane (CID 157436749) is (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane.
What is the SMILES notation for (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane?
The canonical SMILES for (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane is N[C@H](CN1CCCC1)C1CCCCC1.S.
What is the InChIKey of (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane?
The InChIKey is BREUSPWRRFNAMA-UTONKHPSSA-N. The full InChI is InChI=1S/C12H24N2.H2S/c13-12(10-14-8-4-5-9-14)11-6-2-1-3-7-11;/h11-12H,1-10,13H2;1H2/t12-;/m1./s1.
What are the key properties of (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane?
(1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane has a molecular weight of 230.42 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclohexyl-2-pyrrolidin-1-ylethanamine;sulfane is sourced from PubChem (CID 157436749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).