C34H66N6O2 — CID 157437984
4-tert-butyl-1-(1-tert-butylpiperidin-4-yl)piperazin-2-one (PubChem CID 157437984) has the molecular formula C34H66N6O2 and a molecular weight of 590.94 g/mol. Its IUPAC name is 4-tert-butyl-1-(1-tert-butylpiperidin-4-yl)piperazin-2-one.
| Compound Name | 4-tert-butyl-1-(1-tert-butylpiperidin-4-yl)piperazin-2-one |
|---|---|
| PubChem CID | 157437984 |
| Molecular Formula | C34H66N6O2 |
| Molecular Weight | 590.94 g/mol |
| Exact Mass | 590.52 |
| IUPAC Name | 4-tert-butyl-1-(1-tert-butylpiperidin-4-yl)piperazin-2-one |
| SMILES | CC(C)(C)N1CCC(N2CCN(C(C)(C)C)CC2=O)CC1.CC(C)(C)N1CCC(N2CCN(C(C)(C)C)CC2=O)CC1 |
| InChI | InChI=1S/2C17H33N3O/c2*1-16(2,3)18-9-7-14(8-10-18)20-12-11-19(13-15(20)21)17(4,5)6/h2*14H,7-13H2,1-6H3 |
| InChIKey | BRIHDQMFRBIZLH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.94 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |