C38H72N6O2 — CID 19834314
N,N,N',N'-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 19834314) has the molecular formula C38H72N6O2 and a molecular weight of 645.03 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N,N,N',N'-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 19834314 |
| Molecular Formula | C38H72N6O2 |
| Molecular Weight | 645.03 g/mol |
| Exact Mass | 644.57 |
| IUPAC Name | N,N,N',N'-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC1(C)CC(N(C(=O)C(=O)N(C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C38H72N6O2/c1-31(2)17-25(18-32(3,4)39-31)43(26-19-33(5,6)40-34(7,8)20-26)29(45)30(46)44(27-21-35(9,10)41-36(11,12)22-27)28-23-37(13,14)42-38(15,16)24-28/h25-28,39-42H,17-24H2,1-16H3 |
| InChIKey | NTRBZKMXVCCHAL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.03 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|