C24H45N5O2 — CID 19373533
1-(2,2,6,6-tetramethylpiperidin-4-yl)-4-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]piperazine-2,3-dione (PubChem CID 19373533) has the molecular formula C24H45N5O2 and a molecular weight of 435.66 g/mol. Its IUPAC name is 1-(2,2,6,6-tetramethylpiperidin-4-yl)-4-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]piperazine-2,3-dione.
| Compound Name | 1-(2,2,6,6-tetramethylpiperidin-4-yl)-4-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 19373533 |
| Molecular Formula | C24H45N5O2 |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.36 |
| IUPAC Name | 1-(2,2,6,6-tetramethylpiperidin-4-yl)-4-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]piperazine-2,3-dione |
| SMILES | CC1(C)CC(NCCN2CCN(C3CC(C)(C)NC(C)(C)C3)C(=O)C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C24H45N5O2/c1-21(2)13-17(14-22(3,4)26-21)25-9-10-28-11-12-29(20(31)19(28)30)18-15-23(5,6)27-24(7,8)16-18/h17-18,25-27H,9-16H2,1-8H3 |
| InChIKey | NERSPDLKUJZKCI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|