C28H54N4O2 — CID 19834311
N,N'-dibutyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 19834311) has the molecular formula C28H54N4O2 and a molecular weight of 478.77 g/mol. Its IUPAC name is N,N'-dibutyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N,N'-dibutyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 19834311 |
| Molecular Formula | C28H54N4O2 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.42 |
| IUPAC Name | N,N'-dibutyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CCCCN(C(=O)C(=O)N(CCCC)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C28H54N4O2/c1-11-13-15-31(21-17-25(3,4)29-26(5,6)18-21)23(33)24(34)32(16-14-12-2)22-19-27(7,8)30-28(9,10)20-22/h21-22,29-30H,11-20H2,1-10H3 |
| InChIKey | LVRRMHCVVJPTLU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|