C22H39N3O2 — CID 51359789
(6S)-1-[[1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione (PubChem CID 51359789) has the molecular formula C22H39N3O2 and a molecular weight of 377.57 g/mol. Its IUPAC name is (6S)-1-[[1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione.
| Compound Name | (6S)-1-[[1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 51359789 |
| Molecular Formula | C22H39N3O2 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.30 |
| IUPAC Name | (6S)-1-[[1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione |
| SMILES | CC(C)C[C@H]1CNC(=O)C(=O)N1CC1CCN(CC2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C22H39N3O2/c1-16(2)12-20-13-23-21(26)22(27)25(20)15-19-8-10-24(11-9-19)14-18-6-4-17(3)5-7-18/h16-20H,4-15H2,1-3H3,(H,23,26)/t17?,18?,20-/m0/s1 |
| InChIKey | CWVZOTONFNPZFE-QLOJAFMTSA-N |
| XLogP | 2.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|