C17H29N3O2 — CID 45281023
1-[[1-(2-cyclopentylethyl)piperidin-4-yl]methyl]piperazine-2,3-dione (PubChem CID 45281023) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-[[1-(2-cyclopentylethyl)piperidin-4-yl]methyl]piperazine-2,3-dione.
| Compound Name | 1-[[1-(2-cyclopentylethyl)piperidin-4-yl]methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 45281023 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-[[1-(2-cyclopentylethyl)piperidin-4-yl]methyl]piperazine-2,3-dione |
| SMILES | O=C1NCCN(CC2CCN(CCC3CCCC3)CC2)C1=O |
| InChI | InChI=1S/C17H29N3O2/c21-16-17(22)20(12-8-18-16)13-15-6-10-19(11-7-15)9-5-14-3-1-2-4-14/h14-15H,1-13H2,(H,18,21) |
| InChIKey | OPMONQJYAQVVGJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|