C19H35N3O2 — CID 51359788
(6S)-1-[[1-(3-methylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione (PubChem CID 51359788) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is (6S)-1-[[1-(3-methylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione.
| Compound Name | (6S)-1-[[1-(3-methylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 51359788 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | (6S)-1-[[1-(3-methylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione |
| SMILES | CC(C)CCN1CCC(CN2C(=O)C(=O)NC[C@@H]2CC(C)C)CC1 |
| InChI | InChI=1S/C19H35N3O2/c1-14(2)5-8-21-9-6-16(7-10-21)13-22-17(11-15(3)4)12-20-18(23)19(22)24/h14-17H,5-13H2,1-4H3,(H,20,23)/t17-/m0/s1 |
| InChIKey | CGTVBTKDHXQKHM-KRWDZBQOSA-N |
| XLogP | 2.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|