C26H50N6O2 — CID 5186402
2-[4-[2-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]piperazin-1-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 5186402) has the molecular formula C26H50N6O2 and a molecular weight of 478.73 g/mol. Its IUPAC name is 2-[4-[2-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]piperazin-1-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | 2-[4-[2-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]piperazin-1-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 5186402 |
| Molecular Formula | C26H50N6O2 |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 478.40 |
| IUPAC Name | 2-[4-[2-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]piperazin-1-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | CC1(C)CC(NC(=O)CN2CCN(CC(=O)NC3CC(C)(C)NC(C)(C)C3)CC2)CC(C)(C)N1 |
| InChI | InChI=1S/C26H50N6O2/c1-23(2)13-19(14-24(3,4)29-23)27-21(33)17-31-9-11-32(12-10-31)18-22(34)28-20-15-25(5,6)30-26(7,8)16-20/h19-20,29-30H,9-18H2,1-8H3,(H,27,33)(H,28,34) |
| InChIKey | LWNDZDNQGWFKDZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |