C21H42N2O2 — CID 157438683
tert-butyl 2-tert-butylpyrrolidine-1-carboxylate;2-tert-butylpyrrolidine (PubChem CID 157438683) has the molecular formula C21H42N2O2 and a molecular weight of 354.58 g/mol. Its IUPAC name is tert-butyl 2-tert-butylpyrrolidine-1-carboxylate;2-tert-butylpyrrolidine.
| Compound Name | tert-butyl 2-tert-butylpyrrolidine-1-carboxylate;2-tert-butylpyrrolidine |
|---|---|
| PubChem CID | 157438683 |
| Molecular Formula | C21H42N2O2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.32 |
| IUPAC Name | tert-butyl 2-tert-butylpyrrolidine-1-carboxylate;2-tert-butylpyrrolidine |
| SMILES | CC(C)(C)C1CCCN1.CC(C)(C)OC(=O)N1CCCC1C(C)(C)C |
| InChI | InChI=1S/C13H25NO2.C8H17N/c1-12(2,3)10-8-7-9-14(10)11(15)16-13(4,5)6;1-8(2,3)7-5-4-6-9-7/h10H,7-9H2,1-6H3;7,9H,4-6H2,1-3H3 |
| InChIKey | BRKGAENTFAIPGC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |