C31H28Br2N2O7 — CID 157440801
2-(2,2-dibromoethenyl)-4-methoxy-3-phenylmethoxyaniline;3-methoxy-6-nitro-2-phenylmethoxybenzaldehyde (PubChem CID 157440801) has the molecular formula C31H28Br2N2O7 and a molecular weight of 700.38 g/mol. Its IUPAC name is 2-(2,2-dibromoethenyl)-4-methoxy-3-phenylmethoxyaniline;3-methoxy-6-nitro-2-phenylmethoxybenzaldehyde.
| Compound Name | 2-(2,2-dibromoethenyl)-4-methoxy-3-phenylmethoxyaniline;3-methoxy-6-nitro-2-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 157440801 |
| Molecular Formula | C31H28Br2N2O7 |
| Molecular Weight | 700.38 g/mol |
| Exact Mass | 698.03 |
| IUPAC Name | 2-(2,2-dibromoethenyl)-4-methoxy-3-phenylmethoxyaniline;3-methoxy-6-nitro-2-phenylmethoxybenzaldehyde |
| SMILES | COc1ccc(N)c(C=C(Br)Br)c1OCc1ccccc1.COc1ccc([N+](=O)[O-])c(C=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C16H15Br2NO2.C15H13NO5/c1-20-14-8-7-13(19)12(9-15(17)18)16(14)21-10-11-5-3-2-4-6-11;1-20-14-8-7-13(16(18)19)12(9-17)15(14)21-10-11-5-3-2-4-6-11/h2-9H,10,19H2,1H3;2-9H,10H2,1H3 |
| InChIKey | BRQMEYZLXLHDCS-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.38 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|