C10H13N7O7 — CID 157442244
3-ethoxy-1-methyl-5-nitropyrazole;1-methyl-3,5-dinitropyrazole (PubChem CID 157442244) has the molecular formula C10H13N7O7 and a molecular weight of 343.26 g/mol. Its IUPAC name is 3-ethoxy-1-methyl-5-nitropyrazole;1-methyl-3,5-dinitropyrazole.
| Compound Name | 3-ethoxy-1-methyl-5-nitropyrazole;1-methyl-3,5-dinitropyrazole |
|---|---|
| PubChem CID | 157442244 |
| Molecular Formula | C10H13N7O7 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3-ethoxy-1-methyl-5-nitropyrazole;1-methyl-3,5-dinitropyrazole |
| SMILES | CCOc1cc([N+](=O)[O-])n(C)n1.Cn1nc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H9N3O3.C4H4N4O4/c1-3-12-5-4-6(9(10)11)8(2)7-5;1-6-4(8(11)12)2-3(5-6)7(9)10/h4H,3H2,1-2H3;2H,1H3 |
| InChIKey | BRUPEBURBLMIRR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 174.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|