C20H27ClFNO4 — CID 157442756
tert-butyl N-[3-[4-(4-chloro-3-fluorophenoxy)-3-oxobutyl]cyclopentyl]carbamate (PubChem CID 157442756) has the molecular formula C20H27ClFNO4 and a molecular weight of 399.89 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(4-chloro-3-fluorophenoxy)-3-oxobutyl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(4-chloro-3-fluorophenoxy)-3-oxobutyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 157442756 |
| Molecular Formula | C20H27ClFNO4 |
| Molecular Weight | 399.89 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | tert-butyl N-[3-[4-(4-chloro-3-fluorophenoxy)-3-oxobutyl]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CCC(=O)COc2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C20H27ClFNO4/c1-20(2,3)27-19(25)23-14-6-4-13(10-14)5-7-15(24)12-26-16-8-9-17(21)18(22)11-16/h8-9,11,13-14H,4-7,10,12H2,1-3H3,(H,23,25) |
| InChIKey | FOSJDSDEELGSQB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.89 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |